SW 1573[SW-1573,SW1573]

SW 1573[SW-1573,SW1573] - Names and Identifiers

Name	Methyl 4-bromo-3-hydroxybenzoate
Synonyms	SW 1573[SW-1573,SW1573] Methyl 4-bromo-3-hydroxybenzoate METHYL 4-BROMO-3-HYDROXYBENZOATE Methyl 3-hydroxy-4-bromobenzoate 2-Bromo-5-(methoxycarbonyl)phenol 4-bromo-3-hydroxy-Benzoic acidmethyl ester 4-BROMO-3-HYDROXY-BENZOIC ACIDMETHYL ESTER
CAS	106291-80-9
InChI	InChI=1/C8H7BrO3/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4,10H,1H3

SW 1573[SW-1573,SW1573] - Physico-chemical Properties

Molecular Formula	C8H7BrO3
Molar Mass	231.04
Density	1.627±0.06 g/cm3(Predicted)
Melting Point	121-125
Boling Point	318.0±22.0 °C(Predicted)
Flash Point	146.1°C
Solubility	Chloroform, Dichloromethane, Methanol
Vapor Presure	0.0002mmHg at 25°C
Appearance	Solid
Color	White to Almost white
pKa	7.61±0.10(Predicted)
Storage Condition	Inert atmosphere,Room Temperature
Refractive Index	1.585
MDL	MFCD08056372
Physical and Chemical Properties	Storage Conditions: Keep Cold

SW 1573[SW-1573,SW1573] - Risk and Safety

Hazard Symbols	Xi - Irritant
Hazard Note	Irritant/Keep Cold

SW 1573[SW-1573,SW1573] - Introduction

Methyl 4-bromo-3-hydroxybenzoate is an organic compound with the chemical formula C8H7BrO3.

The properties of the compound are as follows:
1. appearance: colorless or light yellow liquid.
2. melting point: about 30-33 degrees Celsius.
3. Boiling point: about 165 degrees Celsius.
4. density: about 1.61 g/cm.
5. Solubility: Soluble in organic solvents such as alcohol and ether, insoluble in water.

The main uses of methyl 4-bromo-3-hydroxybenzoate include:
1. As an intermediate in organic synthesis: it can be used to synthesize other compounds, such as drugs, dyes and polymers.
2. As a raw material for flavors and fragrances: It has a unique smell and can be used to deploy perfumes, fragrances and cosmetics.
3. As an additive for coatings and adhesives: It has good plasticizing properties and can be used to improve the performance of coatings and adhesives.

4-bromo-3-hydroxybenzoic acid methyl ester preparation method generally through the following steps:
1. Methyl p-hydroxybenzoate is reacted with bromine to obtain methyl 4-bromo-3-hydroxybenzoate. The reaction is usually carried out in solution.
2. After the end of the reaction, through appropriate extraction and purification steps, the product to achieve the desired purity.

Regarding safety information, the following should be noted during use and storage of methyl 4-bromo-3-hydroxybenzoate:
1. low ignition point, should be away from the fire and high temperature.
2. Wear appropriate protective gloves, glasses and protective clothing when using.
3. Avoid direct contact with skin and eyes. If contact occurs, rinse with plenty of water immediately and seek medical help.
4. should be stored in a closed container, away from the fire and oxidant.
5. Waste disposal should be carried out in accordance with local regulations to avoid environmental pollution.

Last Update：2024-04-09 20:02:46